|
CAS#: 25316-34-1 Product: N-4-Chlorophenyl-Diamidophosphoric Acid No suppilers available for the product. |
| Name | N-4-Chlorophenyl-Diamidophosphoric Acid |
|---|---|
| Synonyms | Nsc41143 |
| Molecular Structure | ![]() |
| Molecular Formula | C6H8ClN2O2P |
| Molecular Weight | 206.57 |
| CAS Registry Number | 25316-34-1 |
| SMILES | C1=CC(=CC=C1N[P](N)(O)=O)Cl |
| InChI | 1S/C6H8ClN2O2P/c7-5-1-3-6(4-2-5)9-12(8,10)11/h1-4H,(H4,8,9,10,11) |
| InChIKey | SHDXPPRABSXREW-UHFFFAOYSA-N |
| Density | 1.593g/cm3 (Cal.) |
|---|---|
| Boiling point | 379.282°C at 760 mmHg (Cal.) |
| Flash point | 183.183°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N-4-Chlorophenyl-Diamidophosphoric Acid |