|
CAS#: 25333-83-9 Product: 1-[10-[3-(Dimethylamino)Propyl]-10H-Phenothiazin-2-Yl]Propan-1-One Maleate No suppilers available for the product. |
| Name | 1-[10-[3-(Dimethylamino)Propyl]-10H-Phenothiazin-2-Yl]Propan-1-One Maleate |
|---|---|
| Synonyms | Propionylpromazine Maleate; Propiopromazine Maleate; 1-Propanone, 1-[10-[3-(Dimethylamino)Propyl]-2-Phenothiazinyl]-, Maleate (1:1) |
| Molecular Structure | ![]() |
| Molecular Formula | C24H28N2O5S |
| Molecular Weight | 456.56 |
| CAS Registry Number | 25333-83-9 |
| EINECS | 246-861-8 |
| SMILES | C1=C(C=CC3=C1N(CCCN(C)C)C2=CC=CC=C2S3)C(=O)CC.O=C(O)\C=C\C(O)=O |
| InChI | 1S/C20H24N2OS.C4H4O4/c1-4-18(23)15-10-11-20-17(14-15)22(13-7-12-21(2)3)16-8-5-6-9-19(16)24-20;5-3(6)1-2-4(7)8/h5-6,8-11,14H,4,7,12-13H2,1-3H3;1-2H,(H,5,6)(H,7,8)/b;2-1+ |
| InChIKey | BBYDPETWONYPJS-WLHGVMLRSA-N |
| Boiling point | 507.4°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 260.7°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-[10-[3-(Dimethylamino)Propyl]-10H-Phenothiazin-2-Yl]Propan-1-One Maleate |