|
CAS#: 2535-78-6 Product: 1-(4-Chlorophenyl)-3-Phenyl-4,5-Dihydro-1H-Pyrazole No suppilers available for the product. |
| Name | 1-(4-Chlorophenyl)-3-Phenyl-4,5-Dihydro-1H-Pyrazole |
|---|---|
| Synonyms | 1-(4-Chlorophenyl)-3-phenyl-4,5-dihydro-1H-pyrazole # |
| Molecular Structure | ![]() |
| Molecular Formula | C15H13ClN2 |
| Molecular Weight | 256.73 |
| CAS Registry Number | 2535-78-6 |
| SMILES | Clc1ccc(cc1)N3/N=C(/c2ccccc2)CC3 |
| InChI | 1S/C15H13ClN2/c16-13-6-8-14(9-7-13)18-11-10-15(17-18)12-4-2-1-3-5-12/h1-9H,10-11H2 |
| InChIKey | GDXDXELDYZVNBJ-UHFFFAOYSA-N |
| Density | 1.203g/cm3 (Cal.) |
|---|---|
| Boiling point | 394.617°C at 760 mmHg (Cal.) |
| Flash point | 192.458°C (Cal.) |
| Refractive index | 1.627 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-(4-Chlorophenyl)-3-Phenyl-4,5-Dihydro-1H-Pyrazole |