|
CAS#: 25356-95-0 Product: 4-Chloro-alpha-Methyl-Phenethylamine Hydrochloride No suppilers available for the product. |
| Name | 4-Chloro-alpha-Methyl-Phenethylamine Hydrochloride |
|---|---|
| Synonyms | [2-(4-Chlorophenyl)-1-Methyl-Ethyl]Amine Hydrochloride; 4-Chloroamphetamine Hydrochloride; Benzeneethanamine, 4-Chloro-Alpha-Methyl-, Hydrochloride (9Ci) |
| Molecular Structure | ![]() |
| Molecular Formula | C9H13Cl2N |
| Molecular Weight | 206.11 |
| CAS Registry Number | 25356-95-0 |
| SMILES | [H+].C1=C(C=CC(=C1)Cl)CC(N)C.[Cl-] |
| InChI | 1S/C9H12ClN.ClH/c1-7(11)6-8-2-4-9(10)5-3-8;/h2-5,7H,6,11H2,1H3;1H |
| InChIKey | DZAANUYJOGCNLL-UHFFFAOYSA-N |
| Boiling point | 244.2°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 117°C (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 4-Chloro-alpha-Methyl-Phenethylamine Hydrochloride |