|
CAS#: 25387-70-6 Product: Dazadrol maleate No suppilers available for the product. |
| Name | Dazadrol maleate |
|---|---|
| Synonyms | But-2-Enedioic Acid; (4-Chlorophenyl)-(4,5-Dihydro-1H-Imidazol-2-Yl)-(2-Pyridyl)Methanol; But-2-Enedioic Acid; (4-Chlorophenyl)-(4,5-Dihydro-1H-Imidazol-2-Yl)-Pyridin-2-Yl-Methanol; 2-(P-Chlorophenyl-2-(Pyridyl)-Hydroxymethyl)Imidazoline Maleate |
| Molecular Structure | ![]() |
| Molecular Formula | C19H18ClN3O5 |
| Molecular Weight | 403.82 |
| CAS Registry Number | 25387-70-6 |
| SMILES | C3=C(C(O)(C1=NCCN1)C2=NC=CC=C2)C=CC(=C3)Cl.O=C(O)\C=C/C(=O)O |
| InChI | 1S/C15H14ClN3O.C4H4O4/c16-12-6-4-11(5-7-12)15(20,14-18-9-10-19-14)13-3-1-2-8-17-13;5-3(6)1-2-4(7)8/h1-8,20H,9-10H2,(H,18,19);1-2H,(H,5,6)(H,7,8)/b;2-1- |
| InChIKey | UFDGEMYZSPSGFD-BTJKTKAUSA-N |
| Boiling point | 529.7°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 274.1°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Dazadrol maleate |