|
CAS#: 25413-17-6 Product: 6,8-Dichloro-5-Methylquinoline No suppilers available for the product. |
| Name | 6,8-Dichloro-5-Methylquinoline |
|---|---|
| Synonyms | 6,8-Dichloro-5-Methyl-Quinoline; Nsc158942 |
| Molecular Structure | ![]() |
| Molecular Formula | C10H7Cl2N |
| Molecular Weight | 212.08 |
| CAS Registry Number | 25413-17-6 |
| SMILES | C1=C(Cl)C2=C(C(=C1Cl)C)C=CC=N2 |
| InChI | 1S/C10H7Cl2N/c1-6-7-3-2-4-13-10(7)9(12)5-8(6)11/h2-5H,1H3 |
| InChIKey | GRAUOVRJUHWLGC-UHFFFAOYSA-N |
| Density | 1.351g/cm3 (Cal.) |
|---|---|
| Boiling point | 326.701°C at 760 mmHg (Cal.) |
| Flash point | 181.278°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 6,8-Dichloro-5-Methylquinoline |