|
CAS#: 25441-52-5 Product: 1-(2-Hydroxy-4-Tert-Butyl-Phenyl)Propan-1-One No suppilers available for the product. |
| Name | 1-(2-Hydroxy-4-Tert-Butyl-Phenyl)Propan-1-One |
|---|---|
| Synonyms | 1-(4-Tert-Butyl-2-Hydroxy-Phenyl)Propan-1-One; Propiophenone, 4-Tert-Butyl-2-Hydroxy-; Propiophenone, 5-Tert-Butyl-2-Hydroxy- |
| Molecular Structure | ![]() |
| Molecular Formula | C13H18O2 |
| Molecular Weight | 206.28 |
| CAS Registry Number | 25441-52-5 |
| SMILES | C1=C(C(=CC=C1C(C)(C)C)C(CC)=O)O |
| InChI | 1S/C13H18O2/c1-5-11(14)10-7-6-9(8-12(10)15)13(2,3)4/h6-8,15H,5H2,1-4H3 |
| InChIKey | UMULQXUXUAKYCY-UHFFFAOYSA-N |
| Density | 1.018g/cm3 (Cal.) |
|---|---|
| Boiling point | 309.344°C at 760 mmHg (Cal.) |
| Flash point | 130.846°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-(2-Hydroxy-4-Tert-Butyl-Phenyl)Propan-1-One |