|
CAS#: 25466-96-0 Product: 6-Nitro-2-Phenyl-4H-1,3-Benzodioxine No suppilers available for the product. |
| Name | 6-Nitro-2-Phenyl-4H-1,3-Benzodioxine |
|---|---|
| Synonyms | 1,3-Benzodioxan,6-nitro-2-phenyl- |
| Molecular Structure | ![]() |
| Molecular Formula | C14H11NO4 |
| Molecular Weight | 257.24 |
| CAS Registry Number | 25466-96-0 |
| SMILES | c1ccc(cc1)C2OCc3cc(ccc3O2)[N+](=O)[O-] |
| InChI | 1S/C14H11NO4/c16-15(17)12-6-7-13-11(8-12)9-18-14(19-13)10-4-2-1-3-5-10/h1-8,14H,9H2 |
| InChIKey | CYXGIQBCPAGGSE-UHFFFAOYSA-N |
| Density | 1.323g/cm3 (Cal.) |
|---|---|
| Boiling point | 440.417°C at 760 mmHg (Cal.) |
| Flash point | 204.757°C (Cal.) |
| Refractive index | 1.617 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 6-Nitro-2-Phenyl-4H-1,3-Benzodioxine |