|
CAS#: 25495-63-0 Product: 3beta,17,20-Trihydroxy-5alpha-Lanosta-7,9(11)-Dien-18-Oic Acid gamma-Lactone No suppilers available for the product. |
| Name | 3beta,17,20-Trihydroxy-5alpha-Lanosta-7,9(11)-Dien-18-Oic Acid gamma-Lactone |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C30H46O4 |
| Molecular Weight | 470.69 |
| CAS Registry Number | 25495-63-0 |
| SMILES | [C@@]245[C@](C1=CC[C@@H]3[C@@](C1=CC2)(CC[C@H](O)C3(C)C)C)(CC[C@@]4([C@@](CCCC(C)C)(C)OC5=O)O)C |
| InChI | 1S/C30H46O4/c1-19(2)9-8-14-28(7)30(33)18-17-27(6)21-10-11-22-25(3,4)23(31)13-15-26(22,5)20(21)12-16-29(27,30)24(32)34-28/h10,12,19,22-23,31,33H,8-9,11,13-18H2,1-7H3/t22-,23-,26+,27-,28-,29+,30-/m0/s1 |
| InChIKey | NDXCQFYDQPZSKS-WBLNUXJMSA-N |
| Density | 1.138g/cm3 (Cal.) |
|---|---|
| Boiling point | 613.289°C at 760 mmHg (Cal.) |
| Flash point | 194.897°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3beta,17,20-Trihydroxy-5alpha-Lanosta-7,9(11)-Dien-18-Oic Acid gamma-Lactone |