|
CAS#: 25525-87-5 Product: (-)-2-Imino-4-carbethoxy-1,3-diazacycloheptane hydrochloride No suppilers available for the product. |
| Name | (-)-2-Imino-4-carbethoxy-1,3-diazacycloheptane hydrochloride |
|---|---|
| Synonyms | 2-Amino-4,5,6,7-Tetrahydro-3H-1,3-Diazepine-4-Carboxylic Acid Ethyl Ester Hydrochloride; (-)-Hexahydro-2-Imino-1H-1,3-Diazepine-4-Carboxylic Acid Ethyl Ester Hydrochloride; 1H-1,3-Diazepine-4-Carboxylic Acid, Hexahydro-2-Imino-, Ethyl Ester, Monohydrochloride, (-)- |
| Molecular Structure | ![]() |
| Molecular Formula | C8H16ClN3O2 |
| Molecular Weight | 221.69 |
| CAS Registry Number | 25525-87-5 |
| SMILES | [H+].C(OC(=O)C1NC(=NCCC1)N)C.[Cl-] |
| InChI | 1S/C8H15N3O2.ClH/c1-2-13-7(12)6-4-3-5-10-8(9)11-6;/h6H,2-5H2,1H3,(H3,9,10,11);1H |
| InChIKey | JISGSYMKPLXNTK-UHFFFAOYSA-N |
| Boiling point | 298.6°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 134.4°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (-)-2-Imino-4-carbethoxy-1,3-diazacycloheptane hydrochloride |