|
CAS#: 25532-79-0 Product: 1-Methyl-4-[(2E)-6-Methyl-2,5-Heptadien-2-Yl]Cyclohexene No suppilers available for the product. |
| Name | 1-Methyl-4-[(2E)-6-Methyl-2,5-Heptadien-2-Yl]Cyclohexene |
|---|---|
| Synonyms | < i> trans< /i> -& α |
| Molecular Structure | ![]() |
| Molecular Formula | C15H24 |
| Molecular Weight | 204.35 |
| CAS Registry Number | 25532-79-0 |
| SMILES | C(=C(/C1C\C=C(/CC1)C)C)\C\C=C(/C)C |
| InChI | 1S/C15H24/c1-12(2)6-5-7-14(4)15-10-8-13(3)9-11-15/h6-8,15H,5,9-11H2,1-4H3/b14-7+ |
| InChIKey | YHBUQBJHSRGZNF-VGOFMYFVSA-N |
| Density | 0.86g/cm3 (Cal.) |
|---|---|
| Boiling point | 276.896°C at 760 mmHg (Cal.) |
| Flash point | 110.505°C (Cal.) |
| Refractive index | 1.49 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-Methyl-4-[(2E)-6-Methyl-2,5-Heptadien-2-Yl]Cyclohexene |