|
CAS#: 25545-89-5 Product: Ammonium Naphthalene-1-Acetate No suppilers available for the product. |
| Name | Ammonium Naphthalene-1-Acetate |
|---|---|
| Synonyms | Ammonia; 2-(1-Naphthyl)Acetic Acid; Azane; 2-Naphthalen-1-Ylethanoic Acid; 1-Naphthaleneacetic Acid, Ammonium Salt |
| Molecular Structure | ![]() |
| Molecular Formula | C12H13NO2 |
| Molecular Weight | 203.24 |
| CAS Registry Number | 25545-89-5 |
| EINECS | 247-088-9 |
| SMILES | C1=CC=C2C(=C1CC(O)=O)C=CC=C2.N |
| InChI | 1S/C12H10O2.H3N/c13-12(14)8-10-6-3-5-9-4-1-2-7-11(9)10;/h1-7H,8H2,(H,13,14);1H3 |
| InChIKey | DFJCVWWLYPHXNW-UHFFFAOYSA-N |
| Boiling point | 373.2°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 270.1°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Ammonium Naphthalene-1-Acetate |