|
CAS#: 25555-15-1 Product: 4-(Phenylthio)-alpha-(Dimethylhydrazono)Acetophenone No suppilers available for the product. |
| Name | 4-(Phenylthio)-alpha-(Dimethylhydrazono)Acetophenone |
|---|---|
| Synonyms | (2E)-2-(Dimethylhydrazono)-1-(4-Phenylsulfanylphenyl)Ethanone; (2E)-2-(Dimethylhydrazono)-1-[4-(Phenylthio)Phenyl]Ethanone; Brn 2461472 |
| Molecular Structure | ![]() |
| Molecular Formula | C16H16N2OS |
| Molecular Weight | 284.38 |
| CAS Registry Number | 25555-15-1 |
| SMILES | C1=C(C(=O)/C=N/N(C)C)C=CC(=C1)SC2=CC=CC=C2 |
| InChI | 1S/C16H16N2OS/c1-18(2)17-12-16(19)13-8-10-15(11-9-13)20-14-6-4-3-5-7-14/h3-12H,1-2H3/b17-12+ |
| InChIKey | WUGFTPNHNCVWSP-SFQUDFHCSA-N |
| Density | 1.099g/cm3 (Cal.) |
|---|---|
| Boiling point | 445.894°C at 760 mmHg (Cal.) |
| Flash point | 223.469°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-(Phenylthio)-alpha-(Dimethylhydrazono)Acetophenone |