|
CAS#: 25567-68-4 Product: Chloronitrotoluene No suppilers available for the product. |
| Name | Chloronitrotoluene |
|---|---|
| Synonyms | (Chloro-Nitro-Methyl)Benzene; Chloronitrotoluene; Chloronitrotoluenes, Liquid [Un2433] [Poison] |
| Molecular Structure | ![]() |
| Molecular Formula | C7H6ClNO2 |
| Molecular Weight | 171.58 |
| CAS Registry Number | 25567-68-4 |
| EINECS | 247-110-7 |
| SMILES | C1=CC=CC=C1C(Cl)[N+]([O-])=O |
| InChI | 1S/C7H6ClNO2/c8-7(9(10)11)6-4-2-1-3-5-6/h1-5,7H |
| InChIKey | BVJSGOYEEDZAGW-UHFFFAOYSA-N |
| Density | 1.313g/cm3 (Cal.) |
|---|---|
| Boiling point | 236.697°C at 760 mmHg (Cal.) |
| Flash point | 96.951°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Chloronitrotoluene |