| LGC Standards | UK | Inquire | ||
|---|---|---|---|---|
![]() |
+44 (20) 8943-8480 | |||
![]() |
uksales@lgcstandards.com | |||
| Chemical manufacturer since 2007 | ||||
| Classification | Analytical chemistry >> Standard >> Pharmacopoeia standards and magazine standards |
|---|---|
| Name | 5H-Dibenzo(a,d)Cycloheptene |
| Synonyms | Dibenzocycloheptatriene; 5H-Dibenzo[A,D][7]Annulene; Chebi:35642 |
| Molecular Structure | ![]() |
| Molecular Formula | C15H12 |
| Molecular Weight | 192.26 |
| CAS Registry Number | 256-81-5 |
| EINECS | 205-969-5 |
| SMILES | C1=CC=CC2=C1CC3=C(C=C2)C=CC=C3 |
| InChI | 1S/C15H12/c1-3-7-14-11-15-8-4-2-6-13(15)10-9-12(14)5-1/h1-10H,11H2 |
| InChIKey | QPJORFLSOJAUNL-UHFFFAOYSA-N |
| Density | 1.086g/cm3 (Cal.) |
|---|---|
| Boiling point | 322.135°C at 760 mmHg (Cal.) |
| Flash point | 155.181°C (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 5H-Dibenzo(a,d)Cycloheptene |