|
CAS#: 25643-88-3 Product: 1-(3'-Amino-3'-Carboxypropyl)Adenine No suppilers available for the product. |
| Name | 1-(3'-Amino-3'-Carboxypropyl)Adenine |
|---|---|
| Synonyms | 2-Amino-4-(6-Amino-1-Purinyl)Butanoic Acid; 2-Amino-4-(6-Aminopurin-1-Yl)Butyric Acid; 1-(3'-Amino-3'-Carboxypropyl)Adenine |
| Molecular Structure | ![]() |
| Molecular Formula | C9H12N6O2 |
| Molecular Weight | 236.23 |
| CAS Registry Number | 25643-88-3 |
| SMILES | C([N]2C=NC1=NC=NC1=C2N)CC(C(=O)O)N |
| InChI | 1S/C9H12N6O2/c10-5(9(16)17)1-2-15-4-14-8-6(7(15)11)12-3-13-8/h3-5H,1-2,10-11H2,(H,16,17) |
| InChIKey | DEJJDJCXTZJXEJ-UHFFFAOYSA-N |
| Density | 1.768g/cm3 (Cal.) |
|---|---|
| Boiling point | 454.243°C at 760 mmHg (Cal.) |
| Flash point | 228.518°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-(3'-Amino-3'-Carboxypropyl)Adenine |