|
CAS#: 25665-08-1 Product: 1-(2-Ethylhexyl)Biguanide Monohydrochloride No suppilers available for the product. |
| Name | 1-(2-Ethylhexyl)Biguanide Monohydrochloride |
|---|---|
| Synonyms | 1-(Diaminomethylene)-2-(2-Ethylhexyl)Guanidine Hydrochloride; 1-(2-Ethylhexyl)Biguanide Monohydrochloride |
| Molecular Structure | ![]() |
| Molecular Formula | C10H24ClN5 |
| Molecular Weight | 249.79 |
| CAS Registry Number | 25665-08-1 |
| EINECS | 247-173-0 |
| SMILES | [H+].C(C(CC)CN=C(N)N=C(N)N)CCC.[Cl-] |
| InChI | 1S/C10H23N5.ClH/c1-3-5-6-8(4-2)7-14-10(13)15-9(11)12;/h8H,3-7H2,1-2H3,(H6,11,12,13,14,15);1H |
| InChIKey | DXSBUCPFFVHNST-UHFFFAOYSA-N |
| Boiling point | 368°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 176.3°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-(2-Ethylhexyl)Biguanide Monohydrochloride |