| Name | Phenyl-Pyridin-4-Yldiazene |
|---|---|
| Synonyms | Phenyl-(4-Pyridyl)Diazene; Phenyl-Pyridin-4-Yl-Diazene; 4-Phenylazopyridine |
| Molecular Structure | ![]() |
| Molecular Formula | C11H9N3 |
| Molecular Weight | 183.21 |
| CAS Registry Number | 2569-58-6 |
| SMILES | C1=CC=C(C=C1)N=NC2=CC=NC=C2 |
| InChI | 1S/C11H9N3/c1-2-4-10(5-3-1)13-14-11-6-8-12-9-7-11/h1-9H |
| InChIKey | STGZUKHALNSQAG-UHFFFAOYSA-N |
| Density | 1.099g/cm3 (Cal.) |
|---|---|
| Boiling point | 317.594°C at 760 mmHg (Cal.) |
| Flash point | 145.876°C (Cal.) |
| (1) | Nadja Sändig and Francesco Zerbetto. Laws of thermal diffusion of individual molecules on the gold surface, Phys. Chem. Chem. Phys., 2011, 13, 13690. |
|---|---|
| Market Analysis Reports |
| List of Reports Available for Phenyl-Pyridin-4-Yldiazene |