|
CAS#: 25705-58-2 Product: 2,3-Dibromo-1,4-Benzoquinone No suppilers available for the product. |
| Name | 2,3-Dibromo-1,4-Benzoquinone |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C6H2Br2O2 |
| Molecular Weight | 265.89 |
| CAS Registry Number | 25705-58-2 |
| SMILES | BrC=1C(=O)\C=C/C(=O)C=1Br |
| InChI | 1S/C6H2Br2O2/c7-5-3(9)1-2-4(10)6(5)8/h1-2H |
| InChIKey | TYFXNGJGIBMEFV-UHFFFAOYSA-N |
| Density | 2.401g/cm3 (Cal.) |
|---|---|
| Boiling point | 264.283°C at 760 mmHg (Cal.) |
| Flash point | 107.7°C (Cal.) |
| Refractive index | 1.698 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,3-Dibromo-1,4-Benzoquinone |