|
CAS#: 25724-50-9 Product: 3,5-Dimethyl-1-[(Trichloromethyl)Thio]-1H-Pyrazole No suppilers available for the product. |
| Name | 3,5-Dimethyl-1-[(Trichloromethyl)Thio]-1H-Pyrazole |
|---|---|
| Synonyms | 3,5-Dimethyl-1-(Trichloromethylthio)Pyrazole; Brn 0147011; Nsc 55645 |
| Molecular Structure | ![]() |
| Molecular Formula | C6H7Cl3N2S |
| Molecular Weight | 245.55 |
| CAS Registry Number | 25724-50-9 |
| SMILES | C1=C([N](N=C1C)SC(Cl)(Cl)Cl)C |
| InChI | 1S/C6H7Cl3N2S/c1-4-3-5(2)11(10-4)12-6(7,8)9/h3H,1-2H3 |
| InChIKey | JOYZSUIELWWXHQ-UHFFFAOYSA-N |
| Density | 1.514g/cm3 (Cal.) |
|---|---|
| Boiling point | 244.224°C at 760 mmHg (Cal.) |
| Flash point | 101.503°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3,5-Dimethyl-1-[(Trichloromethyl)Thio]-1H-Pyrazole |