|
CAS#: 2573-70-8 Product: Dibutyl phosphinodithioic acid, ammonium salt No suppilers available for the product. |
| Name | Dibutyl phosphinodithioic acid, ammonium salt |
|---|---|
| Synonyms | Ammonium Dibutyl-Sulfido-Thioxo-Phosphorane; Ammonium Dibutyl-Sulfido-Thioxophosphorane; Azanium Dibutyl-Sulfanylidene-Sulfido-Phosphorane |
| Molecular Structure | ![]() |
| Molecular Formula | C8H22NPS2 |
| Molecular Weight | 227.36 |
| CAS Registry Number | 2573-70-8 |
| SMILES | C([P]([S-])(=S)CCCC)CCC.[NH4+] |
| InChI | 1S/C8H19PS2.H3N/c1-3-5-7-9(10,11)8-6-4-2;/h3-8H2,1-2H3,(H,10,11);1H3 |
| InChIKey | TZBFOYUKLPIUNY-UHFFFAOYSA-N |
| Boiling point | 265.3°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 114.3°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Dibutyl phosphinodithioic acid, ammonium salt |