|
CAS#: 25835-57-8 Product: 1,6:8,13-Propane-1,3-diylidene[14]annulene No suppilers available for the product. |
| Name | 1,6:8,13-Propane-1,3-diylidene[14]annulene |
|---|---|
| Synonyms | 12H-1,11-Methenobenzo(1,2:4,5)Dicycloheptene, 11A,12A-Dihydro- |
| Molecular Structure | ![]() |
| Molecular Formula | C17H14 |
| Molecular Weight | 218.30 |
| CAS Registry Number | 25835-57-8 |
| SMILES | C2C1C3=CC=CC=C1C=C4C2C(=C3)C=CC=C4 |
| InChI | 1S/C17H14/c1-2-6-13-10-15-8-4-3-7-14-9-12(5-1)16(13)11-17(14)15/h1-10,16-17H,11H2 |
| InChIKey | NBQPLJXSOLHLEA-UHFFFAOYSA-N |
| Density | 1.164g/cm3 (Cal.) |
|---|---|
| Boiling point | 506.846°C at 760 mmHg (Cal.) |
| Flash point | 218.828°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,6:8,13-Propane-1,3-diylidene[14]annulene |