Online Database of Chemicals from Around the World
|
CAS#: 2591-92-6 Product: 1,2,3,4,9,9-Hexachloro-1,4,4a,8a-tetrahydro-1,4-Methanonaphthalene-5,8-dione No suppilers available for the product. |
| Name | 1,2,3,4,9,9-Hexachloro-1,4,4a,8a-tetrahydro-1,4-Methanonaphthalene-5,8-dione |
|---|---|
| Synonyms | Tricyclo[6.2.1.0(2,7)]Undeca-4,9-Dien-3,6-Dione, 1,8,9,10,11,11-Hexachloro-; Nsc49583 |
| Molecular Structure |  |
| Molecular Formula | C11H4Cl6O2 |
| Molecular Weight | 380.87 |
| CAS Registry Number | 2591-92-6 |
| SMILES | O=C2C1C3(C(C(Cl)(C1C(C=C2)=O)C(=C3Cl)Cl)(Cl)Cl)Cl |
| InChI | 1S/C11H4Cl6O2/c12-7-8(13)10(15)6-4(19)2-1-3(18)5(6)9(7,14)11(10,16)17/h1-2,5-6H |
| InChIKey | NLQWHIOPRSWUAS-UHFFFAOYSA-N |
| Density | 1.849g/cm3 (Cal.) |
|---|---|
| Boiling point | 416.982°C at 760 mmHg (Cal.) |
| Flash point | 176.119°C (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 1,2,3,4,9,9-Hexachloro-1,4,4a,8a-tetrahydro-1,4-Methanonaphthalene-5,8-dione |