|
CAS#: 2593-81-9 Product: 2-Methyl-4-Nitroisoindole-1,3-Dione No suppilers available for the product. |
| Name | 2-Methyl-4-Nitroisoindole-1,3-Dione |
|---|---|
| Synonyms | 2-Methyl-4-Nitro-Isoindoline-1,3-Dione; 2-Methyl-4-Nitroisoindoline-1,3-Dione; 2-Methyl-4-Nitro-Isoindoline-1,3-Quinone |
| Molecular Structure | ![]() |
| Molecular Formula | C9H6N2O4 |
| Molecular Weight | 206.16 |
| CAS Registry Number | 2593-81-9 |
| SMILES | C1=CC=C(C2=C1C(=O)N(C2=O)C)[N+]([O-])=O |
| InChI | 1S/C9H6N2O4/c1-10-8(12)5-3-2-4-6(11(14)15)7(5)9(10)13/h2-4H,1H3 |
| InChIKey | FWIZOFDVGZCRTB-UHFFFAOYSA-N |
| Density | 1.534g/cm3 (Cal.) |
|---|---|
| Boiling point | 373.211°C at 760 mmHg (Cal.) |
| Flash point | 179.512°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Methyl-4-Nitroisoindole-1,3-Dione |