|
CAS#: 26020-55-3 Product: Oxetorone No suppilers available for the product. |
| Name | Oxetorone |
|---|---|
| Synonyms | N,N-Dimethylbenzofuro(3,2-C)(1)Benzoxepin-Delta6(12H),Gamma-Propylamine; Oxetorone |
| Molecular Structure | ![]() |
| Molecular Formula | C21H21NO2 |
| Molecular Weight | 319.40 |
| CAS Registry Number | 26020-55-3 |
| EINECS | 247-411-3 |
| SMILES | C4=C3C2=C(\C(C1=C(C=CC=C1)OC2)=C/CCN(C)C)OC3=CC=C4 |
| InChI | 1S/C21H21NO2/c1-22(2)13-7-10-17-15-8-3-5-11-19(15)23-14-18-16-9-4-6-12-20(16)24-21(17)18/h3-6,8-12H,7,13-14H2,1-2H3/b17-10- |
| InChIKey | VZVRZTZPHOHSCK-YVLHZVERSA-N |
| Density | 1.202g/cm3 (Cal.) |
|---|---|
| Boiling point | 462.727°C at 760 mmHg (Cal.) |
| Flash point | 233.649°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Oxetorone |