|
CAS#: 2608-48-2 Product: (2E,4Z)-5-(4-Nitrophenyl)Penta-2,4-Dienal No suppilers available for the product. |
| Name | (2E,4Z)-5-(4-Nitrophenyl)Penta-2,4-Dienal |
|---|---|
| Synonyms | 2,4-Pentadienal, 5-(4-Nitrophenyl)-; 5-(4-Nitrophenyl)-2,4-Pentadie-1-Al; 5-(4-Nitrophenyl)-2,4-Pentadienal |
| Molecular Structure | ![]() |
| Molecular Formula | C11H9NO3 |
| Molecular Weight | 203.20 |
| CAS Registry Number | 2608-48-2 |
| SMILES | C1=C(C=CC(=C1)\C=C/C=C/C=O)[N+](=O)[O-] |
| InChI | 1S/C11H9NO3/c13-9-3-1-2-4-10-5-7-11(8-6-10)12(14)15/h1-9H/b3-1+,4-2- |
| InChIKey | BKLWQDSDJBFRDF-TZFCGSKZSA-N |
| Density | 1.223g/cm3 (Cal.) |
|---|---|
| Boiling point | 360.009°C at 760 mmHg (Cal.) |
| Flash point | 175.169°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (2E,4Z)-5-(4-Nitrophenyl)Penta-2,4-Dienal |