| Achemica | Switzerland | Inquire | ||
|---|---|---|---|---|
![]() |
+41 (24) 466-2929 | |||
![]() |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| Frinton Laboratories, Inc. | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (856) 722-7037 | |||
![]() |
frinton@frinton.com | |||
| Chemical manufacturer | ||||
| International Laboratory Limited | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (650) 278-9963 | |||
![]() |
admin@intlab.org | |||
| Chemical manufacturer since 2002 | ||||
| TimTec | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (302) 292-8500 | |||
![]() |
info@timtec.com | |||
| Chemical manufacturer | ||||
| Name | Tetrahydrofuran-2,3,4,5-Tetracarboxylic Acid |
|---|---|
| Synonyms | Tetrahydrofuran-2,3,4,5-Tetracarboxylic Acid; Sbb006505 |
| Molecular Structure | ![]() |
| Molecular Formula | C8H8O9 |
| Molecular Weight | 248.15 |
| CAS Registry Number | 26106-63-8 |
| EINECS | 247-461-6 |
| SMILES | O=C(C1C(C(C(O)=O)OC1C(O)=O)C(O)=O)O |
| InChI | 1S/C8H8O9/c9-5(10)1-2(6(11)12)4(8(15)16)17-3(1)7(13)14/h1-4H,(H,9,10)(H,11,12)(H,13,14)(H,15,16) |
| InChIKey | UFOIOXZLTXNHQH-UHFFFAOYSA-N |
| Density | 1.927g/cm3 (Cal.) |
|---|---|
| Melting point | 205°C (Expl.) |
| Boiling point | 597.011°C at 760 mmHg (Cal.) |
| Flash point | 243.903°C (Cal.) |
| SDS | Available |
|---|---|
| (1) | Chun-Sen Liu, E. Carolina Sañudo, Min Hu, Li-Ming Zhou, Liang-Qi Guo, Song-Tao Ma, Li-Jun Gao and Shao-Ming Fang. Metal–organic coordination polymers based on a flexible tetrahydrofuran-2,3,4,5-tetracarboxylate ligand: syntheses, crystal structures, and magnetic/photoluminescent properties, CrystEngComm, 2010, 12, 853. |
|---|---|
| Market Analysis Reports |
| List of Reports Available for Tetrahydrofuran-2,3,4,5-Tetracarboxylic Acid |