|
CAS#: 2615-05-6 Product: 2-Methoxy-4-(2-Methoxyphenyl)Diazenylaniline No suppilers available for the product. |
| Name | 2-Methoxy-4-(2-Methoxyphenyl)Diazenylaniline |
|---|---|
| Synonyms | 2-Methoxy-4-(2-Methoxyphenyl)Azo-Aniline; 2-Methoxy-4-(2-Methoxyphenyl)Azoaniline; [2-Methoxy-4-(2-Methoxyphenyl)Azo-Phenyl]Amine |
| Molecular Structure | ![]() |
| Molecular Formula | C14H15N3O2 |
| Molecular Weight | 257.29 |
| CAS Registry Number | 2615-05-6 |
| SMILES | C1=C(C(=CC=C1)OC)N=NC2=CC(=C(C=C2)N)OC |
| InChI | 1S/C14H15N3O2/c1-18-13-6-4-3-5-12(13)17-16-10-7-8-11(15)14(9-10)19-2/h3-9H,15H2,1-2H3 |
| InChIKey | UCLACBHPELKCCX-UHFFFAOYSA-N |
| Density | 1.178g/cm3 (Cal.) |
|---|---|
| Boiling point | 448.408°C at 760 mmHg (Cal.) |
| Flash point | 224.989°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Methoxy-4-(2-Methoxyphenyl)Diazenylaniline |