|
CAS#: 2618-41-9 Product: Miroestrol No suppilers available for the product. |
| Name | Miroestrol |
|---|---|
| Synonyms | C08831; Miroestrol; 2,12-Methano-1H-Benzo(B)Naphtho(2,1-D)Pyran-4(4Ah)-One, 2,3,10B,11,12,12A-Hexahydro-1,2,4A,8-Tetrahydroxy-11,11-Dimethyl-, (1R-(1Alpha,2Beta,4Abeta,10Bbeta,12Alpha,12Abeta))- |
| Molecular Structure | ![]() |
| Molecular Formula | C20H22O6 |
| Molecular Weight | 358.39 |
| CAS Registry Number | 2618-41-9 |
| SMILES | [C@@]34(C2=COC1=CC(=CC=C1[C@H]2C(C)(C)[C@@H]5[C@H]3[C@@H](O)[C@@](CC4=O)(O)C5)O)O |
| InChI | 1S/C20H22O6/c1-18(2)11-6-19(24)7-14(22)20(25,16(11)17(19)23)12-8-26-13-5-9(21)3-4-10(13)15(12)18/h3-5,8,11,15-17,21,23-25H,6-7H2,1-2H3/t11-,15+,16-,17+,19+,20-/m0/s1 |
| InChIKey | RJKLDOLOCIQYFS-PRTISISMSA-N |
| Density | 1.541g/cm3 (Cal.) |
|---|---|
| Boiling point | 584.124°C at 760 mmHg (Cal.) |
| Flash point | 211.74°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Miroestrol |