|
CAS#: 2619-57-0 Product: 7-Chloro-1-Methyl-5-Phenyl-4,5-Dihydro-3H-1,4-Benzodiazepin-2-One No suppilers available for the product. |
| Name | 7-Chloro-1-Methyl-5-Phenyl-4,5-Dihydro-3H-1,4-Benzodiazepin-2-One |
|---|---|
| Synonyms | 4,5-Dihydrodiazepam; 2H-1,4-Benzodiazepin-2-One, 7-Chloro-1,3,4,5-Tetrahydro-1-Methyl-5-Phenyl- |
| Molecular Structure | ![]() |
| Molecular Formula | C16H15ClN2O |
| Molecular Weight | 286.76 |
| CAS Registry Number | 2619-57-0 |
| SMILES | C1=C(Cl)C=CC2=C1C(NCC(=O)N2C)C3=CC=CC=C3 |
| InChI | 1S/C16H15ClN2O/c1-19-14-8-7-12(17)9-13(14)16(18-10-15(19)20)11-5-3-2-4-6-11/h2-9,16,18H,10H2,1H3 |
| InChIKey | ZYOLWAPZVQXTTM-UHFFFAOYSA-N |
| Density | 1.227g/cm3 (Cal.) |
|---|---|
| Boiling point | 484.641°C at 760 mmHg (Cal.) |
| Flash point | 246.902°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 7-Chloro-1-Methyl-5-Phenyl-4,5-Dihydro-3H-1,4-Benzodiazepin-2-One |