Online Database of Chemicals from Around the World
|
CAS#: 26193-57-7 Product: 1-[(1Z)-2-Bromo-1-Propen-1-Yl]-2,3,4-Trimethylnaphthalene No suppilers available for the product. |
| Name | 1-[(1Z)-2-Bromo-1-Propen-1-Yl]-2,3,4-Trimethylnaphthalene |
|---|---|
| Synonyms | 1-[(1Z)-2-Bromo-1-propenyl]-2,3,4-trimethylnaphthalene #; Naphthalene, 1-(2-bromopropenyl)-2,3,4-trimethyl- |
| Molecular Structure | ![CAS#: 26193-57-7, 1-[(1Z)-2-Bromo-1-Propen-1-Yl]-2,3,4-Trimethylnaphthalene](/moreStructures/26193-57-7.gif) |
| Molecular Formula | C16H17Br |
| Molecular Weight | 289.21 |
| CAS Registry Number | 26193-57-7 |
| SMILES | Br\C(=C/c2c1c(cccc1)c(c(c2C)C)C)C |
| InChI | 1S/C16H17Br/c1-10(17)9-16-13(4)11(2)12(3)14-7-5-6-8-15(14)16/h5-9H,1-4H3/b10-9- |
| InChIKey | HCYDSXFVIBTXLK-KTKRTIGZSA-N |
| Density | 1.278g/cm3 (Cal.) |
|---|---|
| Boiling point | 389.887°C at 760 mmHg (Cal.) |
| Flash point | 207.166°C (Cal.) |
| Refractive index | 1.645 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-[(1Z)-2-Bromo-1-Propen-1-Yl]-2,3,4-Trimethylnaphthalene |