|
CAS#: 2627-62-5 Product: 5-(6-Aminopurin-9-Yl)-4-Chloro-2-(Hydroxymethyl)Oxolan-3-Ol No suppilers available for the product. |
| Name | 5-(6-Aminopurin-9-Yl)-4-Chloro-2-(Hydroxymethyl)Oxolan-3-Ol |
|---|---|
| Synonyms | 5-(6-Aminopurin-9-Yl)-4-Chloro-2-(Hydroxymethyl)Tetrahydrofuran-3-Ol; 5-(6-Amino-9-Purinyl)-4-Chloro-2-(Hydroxymethyl)-3-Tetrahydrofuranol; 5-(6-Aminopurin-9-Yl)-4-Chloro-2-Methylol-Tetrahydrofuran-3-Ol |
| Molecular Structure | ![]() |
| Molecular Formula | C10H12ClN5O3 |
| Molecular Weight | 285.69 |
| CAS Registry Number | 2627-62-5 |
| SMILES | C1=NC3=C([N]1C2OC(C(O)C2Cl)CO)N=CN=C3N |
| InChI | 1S/C10H12ClN5O3/c11-5-7(18)4(1-17)19-10(5)16-3-15-6-8(12)13-2-14-9(6)16/h2-5,7,10,17-18H,1H2,(H2,12,13,14) |
| InChIKey | ADXUXRNLBYKGOA-UHFFFAOYSA-N |
| Density | 2.038g/cm3 (Cal.) |
|---|---|
| Boiling point | 678.209°C at 760 mmHg (Cal.) |
| Flash point | 363.968°C (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 5-(6-Aminopurin-9-Yl)-4-Chloro-2-(Hydroxymethyl)Oxolan-3-Ol |