|
CAS#: 26307-17-5 Product: 2,5-Dimethyl-3,4-Diphenylcyclopentadienone No suppilers available for the product. |
| Name | 2,5-Dimethyl-3,4-Diphenylcyclopentadienone |
|---|---|
| Synonyms | 2,5-Dimethyl-3,4-Di(Phenyl)-1-Cyclopenta-2,4-Dienone; St5409180; Zinc01674474 |
| Molecular Structure | ![]() |
| Molecular Formula | C19H16O |
| Molecular Weight | 260.33 |
| CAS Registry Number | 26307-17-5 |
| SMILES | C3=C(C1=C(C(=O)C(=C1C2=CC=CC=C2)C)C)C=CC=C3 |
| InChI | 1S/C19H16O/c1-13-17(15-9-5-3-6-10-15)18(14(2)19(13)20)16-11-7-4-8-12-16/h3-12H,1-2H3 |
| InChIKey | SOXYIWTUKPMWCG-UHFFFAOYSA-N |
| Density | 1.122g/cm3 (Cal.) |
|---|---|
| Boiling point | 423.8°C at 760 mmHg (Cal.) |
| Flash point | 186.266°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,5-Dimethyl-3,4-Diphenylcyclopentadienone |