Online Database of Chemicals from Around the World
| Achemica | Switzerland | Inquire | ||
|---|---|---|---|---|
 |
+41 (24) 466-2929 | |||
 |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
|
+1 (631) 485-4226 | |||
|
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink massive supplier since 2012 | ||||
| Name | 1,3,5-Trichloro-2,4,6-Trinitro-Benzene |
|---|---|
| Synonyms | 1,3,5-Trichloro-2,4,6-Trinitro-Benzene; 2,4,6-Trichlor-1,3,5-Trinitrobenzol [German]; 2,4,6-Trichloro-1,3,5-Trinitrobenzene |
| Molecular Structure |  |
| Molecular Formula | C6Cl3N3O6 |
| Molecular Weight | 316.44 |
| CAS Registry Number | 2631-68-7 |
| EINECS | 220-115-1 |
| SMILES | C1(=C(C(=C(C(=C1Cl)[N+](=O)[O-])Cl)[N+](=O)[O-])Cl)[N+](=O)[O-] |
| InChI | 1S/C6Cl3N3O6/c7-1-4(10(13)14)2(8)6(12(17)18)3(9)5(1)11(15)16 |
| InChIKey | LZMONXBJUOXABQ-UHFFFAOYSA-N |
| Density | 1.968g/cm3 (Cal.) |
|---|---|
| Boiling point | 403.663°C at 760 mmHg (Cal.) |
| Flash point | 197.929°C (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 1,3,5-Trichloro-2,4,6-Trinitro-Benzene |