|
CAS#: 26311-81-9 Product: 1-Chloro-3,4-dimethyl-1-phenyl-2,5-dihydro-1H-germole No suppilers available for the product. |
| Name | 1-Chloro-3,4-dimethyl-1-phenyl-2,5-dihydro-1H-germole |
|---|---|
| Synonyms | 1-Chloro-3,4-dimethyl-1-phenyl-2,5-dihydro-1H-germole # |
| Molecular Structure | ![]() |
| Molecular Formula | C12H15ClGe |
| Molecular Weight | 267.34 |
| CAS Registry Number | 26311-81-9 |
| SMILES | Cl[Ge]2(c1ccccc1)C/C(=C(\C2)C)C |
| InChI | 1S/C12H15ClGe/c1-10-8-14(13,9-11(10)2)12-6-4-3-5-7-12/h3-7H,8-9H2,1-2H3 |
| InChIKey | NPYITDSJFJCBGE-UHFFFAOYSA-N |
| Boiling point | 284.092°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 106.668°C (Cal.) |
| Refractive index | (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-Chloro-3,4-dimethyl-1-phenyl-2,5-dihydro-1H-germole |