|
CAS#: 26389-55-9 Product: N-(Cyclohexylmethyl)-2,4-Dinitroaniline No suppilers available for the product. |
| Name | N-(Cyclohexylmethyl)-2,4-Dinitroaniline |
|---|---|
| Synonyms | Cyclohexylmethyl-(2,4-dinitro-phenyl)-amine |
| Molecular Structure | ![]() |
| Molecular Formula | C13H17N3O4 |
| Molecular Weight | 279.29 |
| CAS Registry Number | 26389-55-9 |
| SMILES | [O-][N+](=O)c2ccc(NCC1CCCCC1)c([N+]([O-])=O)c2 |
| InChI | 1S/C13H17N3O4/c17-15(18)11-6-7-12(13(8-11)16(19)20)14-9-10-4-2-1-3-5-10/h6-8,10,14H,1-5,9H2 |
| InChIKey | HOIXDOCOXWSDJL-UHFFFAOYSA-N |
| Density | 1.299g/cm3 (Cal.) |
|---|---|
| Boiling point | 441.555°C at 760 mmHg (Cal.) |
| Flash point | 220.845°C (Cal.) |
| Refractive index | 1.611 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N-(Cyclohexylmethyl)-2,4-Dinitroaniline |