|
CAS#: 26389-78-6 Product: Chlornidine No suppilers available for the product. |
| Name | Chlornidine |
|---|---|
| Synonyms | N,N-Bis(2-Chloroethyl)-4-Methyl-2,6-Dinitro-Aniline; Bis(2-Chloroethyl)-(4-Methyl-2,6-Dinitro-Phenyl)Amine; Ai3-62692 |
| Molecular Structure | ![]() |
| Molecular Formula | C11H13Cl2N3O4 |
| Molecular Weight | 322.15 |
| CAS Registry Number | 26389-78-6 |
| SMILES | C1=C(C)C=C(C(=C1[N+]([O-])=O)N(CCCl)CCCl)[N+](=O)[O-] |
| InChI | 1S/C11H13Cl2N3O4/c1-8-6-9(15(17)18)11(10(7-8)16(19)20)14(4-2-12)5-3-13/h6-7H,2-5H2,1H3 |
| InChIKey | XKUWFOYPQIVFMM-UHFFFAOYSA-N |
| Density | 1.444g/cm3 (Cal.) |
|---|---|
| Boiling point | 465.829°C at 760 mmHg (Cal.) |
| Flash point | 235.525°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Chlornidine |