|
CAS#: 26400-27-1 Product: Hydroxymethylpentamethylphosphoramide No suppilers available for the product. |
| Name | Hydroxymethylpentamethylphosphoramide |
|---|---|
| Synonyms | [Bis(Dimethylamino)Phosphoryl-Methyl-Amino]Methanol; (Hydroxymethyl)Pentamethylphosphoric Triamide; Ai3-61440 |
| Molecular Structure | ![]() |
| Molecular Formula | C6H18N3O2P |
| Molecular Weight | 195.20 |
| CAS Registry Number | 26400-27-1 |
| SMILES | C(N([P](N(C)C)(N(C)C)=O)C)O |
| InChI | 1S/C6H18N3O2P/c1-7(2)12(11,8(3)4)9(5)6-10/h10H,6H2,1-5H3 |
| InChIKey | MIDJUYBRPJQVDK-UHFFFAOYSA-N |
| Density | 1.142g/cm3 (Cal.) |
|---|---|
| Boiling point | 282.899°C at 760 mmHg (Cal.) |
| Flash point | 124.893°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Hydroxymethylpentamethylphosphoramide |