|
CAS#: 26454-88-6 Product: 1,4-Diphenyl-2-(Phenylamino)-2-Butene-1,4-Dione No suppilers available for the product. |
| Name | 1,4-Diphenyl-2-(Phenylamino)-2-Butene-1,4-Dione |
|---|---|
| Synonyms | 1,4-Di(Phenyl)-2-(Phenylamino)But-2-Ene-1,4-Dione; 2-Butene-1,4-Dione, 1,4-Diphenyl-2-(Phenylamino)-; 2-Butene-1,4-Dione, 2-Anilino-1,4-Diphenyl- |
| Molecular Structure | ![]() |
| Molecular Formula | C22H17NO2 |
| Molecular Weight | 327.38 |
| CAS Registry Number | 26454-88-6 |
| SMILES | C3=CC=C(C(\C=C(NC1=CC=CC=C1)/C(=O)C2=CC=CC=C2)=O)C=C3 |
| InChI | 1S/C22H17NO2/c24-21(17-10-4-1-5-11-17)16-20(23-19-14-8-3-9-15-19)22(25)18-12-6-2-7-13-18/h1-16,23H/b20-16+ |
| InChIKey | LPGATJZHJUTVAG-CAPFRKAQSA-N |
| Density | 1.21g/cm3 (Cal.) |
|---|---|
| Boiling point | 484.105°C at 760 mmHg (Cal.) |
| Flash point | 161.298°C (Cal.) |
| (1) | Nidhin Paul, Ramalingam Sathishkumar, Chellathurai Anuba and Shanmugam Muthusubramanian. Reactions of diphenacylaniline and diphenacyl sulfide under Gewald conditions: generation of enamines and thioamides, RSC Advances, 2013, 3, 7445. |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 1,4-Diphenyl-2-(Phenylamino)-2-Butene-1,4-Dione |