Online Database of Chemicals from Around the World
|
CAS#: 26485-73-4 Product: 4-Benzyl-1,2-Diphenylpyrazolidine-3,5-Dione No suppilers available for the product. |
| Name | 4-Benzyl-1,2-Diphenylpyrazolidine-3,5-Dione |
|---|---|
| Synonyms | 4-(Benzyl)-1,2-Di(Phenyl)Pyrazolidine-3,5-Quinone; 3,5-Pyrazolidinedione, 4-Benzyl-1,2-Diphenyl-; 4-Benzil-1,2-Difenil-3,5-Dicheto-Pirazolidina [Italian] |
| Molecular Structure |  |
| Molecular Formula | C22H18N2O2 |
| Molecular Weight | 342.40 |
| CAS Registry Number | 26485-73-4 |
| SMILES | C1=CC=CC=C1CC2C(N(N(C2=O)C3=CC=CC=C3)C4=CC=CC=C4)=O |
| InChI | 1S/C22H18N2O2/c25-21-20(16-17-10-4-1-5-11-17)22(26)24(19-14-8-3-9-15-19)23(21)18-12-6-2-7-13-18/h1-15,20H,16H2 |
| InChIKey | GSTJUQAYAGGXPJ-UHFFFAOYSA-N |
| Density | 1.266g/cm3 (Cal.) |
|---|---|
| Boiling point | 484.42°C at 760 mmHg (Cal.) |
| Flash point | 207.246°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-Benzyl-1,2-Diphenylpyrazolidine-3,5-Dione |