|
CAS#: 2650-30-8 Product: Sodium 3,5,5-Trimethylhexanoate No suppilers available for the product. |
| Name | Sodium 3,5,5-Trimethylhexanoate |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C9H17NaO2 |
| Molecular Weight | 180.22 |
| CAS Registry Number | 2650-30-8 |
| EINECS | 220-169-6 |
| SMILES | C(C(C)(C)C)C(CC([O-])=O)C.[Na+] |
| InChI | 1S/C9H18O2.Na/c1-7(5-8(10)11)6-9(2,3)4;/h7H,5-6H2,1-4H3,(H,10,11);/q;+1/p-1 |
| InChIKey | ZHVCSGCGBCHVLW-UHFFFAOYSA-M |
| Boiling point | 243.3°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 109.4°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Sodium 3,5,5-Trimethylhexanoate |