|
CAS#: 2653-63-6 Product: Naphthalen-1-Yl-Naphthalen-2-Yldiazene No suppilers available for the product. |
| Name | Naphthalen-1-Yl-Naphthalen-2-Yldiazene |
|---|---|
| Synonyms | 1-Naphthyl-(2-Naphthyl)Diazene; Naphthalen-1-Yl-Naphthalen-2-Yl-Diazene; 1,2'-Azonaphthalene |
| Molecular Structure | ![]() |
| Molecular Formula | C20H14N2 |
| Molecular Weight | 282.34 |
| CAS Registry Number | 2653-63-6 |
| SMILES | C1=CC=CC2=C1C=CC(=C2)N=NC3=CC=CC4=C3C=CC=C4 |
| InChI | 1S/C20H14N2/c1-2-8-17-14-18(13-12-15(17)6-1)21-22-20-11-5-9-16-7-3-4-10-19(16)20/h1-14H |
| InChIKey | INTYTLPOFHZKQE-UHFFFAOYSA-N |
| Density | 1.13g/cm3 (Cal.) |
|---|---|
| Boiling point | 484.516°C at 760 mmHg (Cal.) |
| Flash point | 239.763°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Naphthalen-1-Yl-Naphthalen-2-Yldiazene |