| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (201) 478-8534 | |||
![]() |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Apollo Scientific Ltd. | UK | Inquire | ||
|---|---|---|---|---|
![]() |
+44 (161) 406-0505 | |||
![]() |
sales@apolloscientific.co.uk | |||
| Chemical manufacturer | ||||
| Indofine Chemical Company, Inc. | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (908) 359-6778 | |||
![]() |
fo@indofinechemical.com | |||
| Chemical manufacturer since 1996 | ||||
| Manchester Organics Ltd. | UK | Inquire | ||
|---|---|---|---|---|
![]() |
+44 (1928) 710-200 | |||
![]() |
info@manchesterorganics.com | |||
| Chemical manufacturer | ||||
| P and M Invest Ltd. | Russian Federation | Inquire | ||
|---|---|---|---|---|
![]() |
+7 (495) 135-6494 | |||
![]() |
sales@fluorine.ru | |||
| Chemical manufacturer | ||||
| SynQuest Labs, Inc. | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (386) 462-0788 | |||
![]() |
info@synquestlabs.com | |||
| Chemical manufacturer | ||||
| Zylexa Pharma Ltd. | UK | Inquire | ||
|---|---|---|---|---|
![]() |
+44 (845) 299-6009/ | |||
![]() |
sales@zylexa-pharma.com,enquiries@zylexa-pharma.com | |||
| Chemical manufacturer | ||||
| Name | 2,3,3,3-Tetrafluoro-2-(Heptafluoropropoxy)-1-Propanol |
|---|---|
| Synonyms | 1H,1H-Perfluoro(2-methyl-3-oxahexan-1-ol); 1H,1H-Undecafluoro(2-methyl-3-oxahexan-1-ol) 97%; 2-(Heptaf |
| Molecular Structure | ![]() |
| Molecular Formula | C6H3F11O2 |
| Molecular Weight | 316.07 |
| CAS Registry Number | 26537-88-2 |
| SMILES | FC(F)(C(F)(F)OC(F)(CO)C(F)(F)F)C(F)(F)F |
| InChI | 1S/C6H3F11O2/c7-2(1-18,4(10,11)12)19-6(16,17)3(8,9)5(13,14)15/h18H,1H2 |
| InChIKey | MSOLHCPBFWYOSH-UHFFFAOYSA-N |
| Density | 1.5529 (Expl.) |
|---|---|
| 1.65g/cm3 (Cal.) | |
| Boiling point | 173.393°C at 760 mmHg (Cal.) |
| 119-120°C (Expl.) | |
| Flash point | 88.648°C (Cal.) |
| Refractive index | 1.3007 (Expl.) |
| 1.29 (Cal.) | |
| Safety Description | Irritant |
|---|---|
| R36/37/38 | |
| S23,S24/25,S36/37/39,S45 | |
| SDS | Available |
| Market Analysis Reports |
| List of Reports Available for 2,3,3,3-Tetrafluoro-2-(Heptafluoropropoxy)-1-Propanol |