|
CAS#: 26593-43-1 Product: N,N-Dimethylphthalamidic Acid Methyl Ester No suppilers available for the product. |
| Name | N,N-Dimethylphthalamidic Acid Methyl Ester |
|---|---|
| Synonyms | 2-(Dimethylamino-Oxomethyl)Benzoic Acid Methyl Ester; 2-(Dimethylcarbamoyl)Benzoic Acid Methyl Ester; Co 101 |
| Molecular Structure | ![]() |
| Molecular Formula | C11H13NO3 |
| Molecular Weight | 207.23 |
| CAS Registry Number | 26593-43-1 |
| SMILES | C1=C(C(=CC=C1)C(=O)OC)C(=O)N(C)C |
| InChI | 1S/C11H13NO3/c1-12(2)10(13)8-6-4-5-7-9(8)11(14)15-3/h4-7H,1-3H3 |
| InChIKey | HJPZFXYWMRWNHV-UHFFFAOYSA-N |
| Density | 1.135g/cm3 (Cal.) |
|---|---|
| Boiling point | 355.348°C at 760 mmHg (Cal.) |
| Flash point | 168.709°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N,N-Dimethylphthalamidic Acid Methyl Ester |