|
CAS#: 26619-93-2 Product: (2R,5S)-6alpha,7alpha-Epoxyaspidofractinine-3beta-Carboxylic Acid Methyl Ester No suppilers available for the product. |
| Name | (2R,5S)-6alpha,7alpha-Epoxyaspidofractinine-3beta-Carboxylic Acid Methyl Ester |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C21H24N2O3 |
| Molecular Weight | 352.43 |
| CAS Registry Number | 26619-93-2 |
| SMILES | [C@]237NC1=CC=CC=C1C25[C@@H]4[C@](C[C@H]3C(OC)=O)([C@@H]6[C@H](CN4CC5)O6)CC7 |
| InChI | 1S/C21H24N2O3/c1-25-17(24)13-10-19-6-7-21(13)20(12-4-2-3-5-14(12)22-21)8-9-23(18(19)20)11-15-16(19)26-15/h2-5,13,15-16,18,22H,6-11H2,1H3/t13-,15-,16-,18-,19+,20?,21+/m0/s1 |
| InChIKey | PKVIZXKEMISSGB-JDGDXTPDSA-N |
| Density | 1.415g/cm3 (Cal.) |
|---|---|
| Boiling point | 526.612°C at 760 mmHg (Cal.) |
| Flash point | 272.285°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (2R,5S)-6alpha,7alpha-Epoxyaspidofractinine-3beta-Carboxylic Acid Methyl Ester |