|
CAS#: 26660-92-4 Product: 5,22-Dihydroporphyrin No suppilers available for the product. |
| Name | 5,22-Dihydroporphyrin |
|---|---|
| Synonyms | phlorin; phlorin porphyrin |
| Molecular Structure | ![]() |
| Molecular Formula | C20H16N4 |
| Molecular Weight | 312.37 |
| CAS Registry Number | 26660-92-4 |
| SMILES | C1C2=CC=C(N2)/C=C\3/C=C/C(=C/C4=N/C(=C\C5=CC=C1N5)/C=C4)/N3 |
| InChI | 1S/C20H16N4/c1-2-14-10-16-5-6-18(23-16)12-20-8-7-19(24-20)11-17-4-3-15(22-17)9-13(1)21-14/h1-11,21,23-24H,12H2/b13-9-,14-10-,17-11- |
| InChIKey | IQDRAVRWQIIASA-VZPOTTSCSA-N |
| Density | 1.4±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 742.5±60.0°C at 760 mmHg (Cal.) |
| Flash point | 402.8±32.9°C (Cal.) |
| Refractive index | 1.752 (Cal.) |
| (1) | Alexandra M. Young, Amber L. Von Ruden and Timothy D. Lash. Pyrazole analogues of porphyrins and oxophlorins, Org. Biomol. Chem., 2011, 9, 6293. |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 5,22-Dihydroporphyrin |