|
CAS#: 26676-89-1 Product: Ascorbigen A No suppilers available for the product. |
| Name | Ascorbigen A |
|---|---|
| Synonyms | Ccris 6833 |
| Molecular Structure | ![]() |
| Molecular Formula | C15H15NO6 |
| Molecular Weight | 305.29 |
| CAS Registry Number | 26676-89-1 |
| SMILES | [C@@]2(O)(C1(OCC(O)C1OC2=O)O)CC3=C[NH]C4=CC=CC=C34 |
| InChI | 1S/C15H15NO6/c17-11-7-21-15(20)12(11)22-13(18)14(15,19)5-8-6-16-10-4-2-1-3-9(8)10/h1-4,6,11-12,16-17,19-20H,5,7H2/t11?,12?,14-,15?/m1/s1 |
| InChIKey | OMSJCIOTCFHSIT-NQRDHLDYSA-N |
| Density | 1.73g/cm3 (Cal.) |
|---|---|
| Boiling point | 644.498°C at 760 mmHg (Cal.) |
| Flash point | 343.58°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Ascorbigen A |