|
CAS#: 2671-50-3 Product: 16,17-Didehydro-Yohimban-16-carboxylic acid methyl ester No suppilers available for the product. |
| Name | 16,17-Didehydro-Yohimban-16-carboxylic acid methyl ester |
|---|---|
| Synonyms | Yohimban-16-Carboxylic Acid, 16,17-Didehydro-, Methyl Ester; Apoyohimbine; Nsc121853 |
| Molecular Structure | ![]() |
| Molecular Formula | C21H24N2O2 |
| Molecular Weight | 336.43 |
| CAS Registry Number | 2671-50-3 |
| SMILES | C2=C1C5=C([NH]C1=CC=C2)C3N(CC4C(C3)C(=CCC4)C(OC)=O)CC5 |
| InChI | 1S/C21H24N2O2/c1-25-21(24)16-7-4-5-13-12-23-10-9-15-14-6-2-3-8-18(14)22-20(15)19(23)11-17(13)16/h2-3,6-8,13,17,19,22H,4-5,9-12H2,1H3 |
| InChIKey | DFDNBRUSLQYVNA-UHFFFAOYSA-N |
| Density | 1.276g/cm3 (Cal.) |
|---|---|
| Boiling point | 510.306°C at 760 mmHg (Cal.) |
| Flash point | 262.424°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 16,17-Didehydro-Yohimban-16-carboxylic acid methyl ester |