|
CAS#: 26730-04-1 Product: 2-Methyl-Phenazine 10-Oxide No suppilers available for the product. |
| Name | 2-Methyl-Phenazine 10-Oxide |
|---|---|
| Synonyms | 2-Methyl-10-Oxido-Phenazin-10-Ium; Phenazine,2-Methyl-10-Oxide; Phenazine, 2-Methyl-, 10-Oxide |
| Molecular Structure | ![]() |
| Molecular Formula | C13H10N2O |
| Molecular Weight | 210.23 |
| CAS Registry Number | 26730-04-1 |
| SMILES | C1=CC=C2C(=C1)N=C3C(=[N+]2[O-])C=C(C=C3)C |
| InChI | 1S/C13H10N2O/c1-9-6-7-11-13(8-9)15(16)12-5-3-2-4-10(12)14-11/h2-8H,1H3 |
| InChIKey | UJWVEXVOFLBGFM-UHFFFAOYSA-N |
| Density | 1.249g/cm3 (Cal.) |
|---|---|
| Boiling point | 415.194°C at 760 mmHg (Cal.) |
| Flash point | 204.902°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Methyl-Phenazine 10-Oxide |