|
CAS#: 2674-91-1 Product: 2-Dimethoxyphosphorylsulfanyl-1-Ethylsulfinylpropane No suppilers available for the product. |
| Name | 2-Dimethoxyphosphorylsulfanyl-1-Ethylsulfinylpropane |
|---|---|
| Synonyms | 2-Dimethoxyphosphorylsulfanyl-1-Ethylsulfinyl-Propane; 2-(Dimethoxyphosphorylthio)-1-Ethylsulfinylpropane; [[(2-Ethylsulfinyl-1-Methyl-Ethyl)Thio]-Methoxy-Phosphoryl]Oxymethane |
| Molecular Structure | ![]() |
| Molecular Formula | C7H17O4PS2 |
| Molecular Weight | 260.30 |
| CAS Registry Number | 2674-91-1 |
| EINECS | 220-221-8 |
| SMILES | C(C)[S](=O)CC(C)S[P](=O)(OC)OC |
| InChI | 1S/C7H17O4PS2/c1-5-14(9)6-7(2)13-12(8,10-3)11-4/h7H,5-6H2,1-4H3 |
| InChIKey | JAYZFNIOOYPIAH-UHFFFAOYSA-N |
| Density | 1.271g/cm3 (Cal.) |
|---|---|
| Boiling point | 382.758°C at 760 mmHg (Cal.) |
| Flash point | 185.286°C (Cal.) |
| (1) | Setshaba D. Khanye, Nikoletta B. Báthori, Gregory S. Smith and Kelly Chibale. Gold(i) derived thiosemicarbazone complexes with rare halogen–halogen interaction–reduction of [Au(damp-C,N)Cl], Dalton Trans., 2010, 39, 2697. |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 2-Dimethoxyphosphorylsulfanyl-1-Ethylsulfinylpropane |